C24H21N3O3 — CID 1392297
(5R)-1',6'-dimethyl-1-naphthalen-1-ylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione (PubChem CID 1392297) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is (5R)-1',6'-dimethyl-1-naphthalen-1-ylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione.
| Compound Name | (5R)-1',6'-dimethyl-1-naphthalen-1-ylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 1392297 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (5R)-1',6'-dimethyl-1-naphthalen-1-ylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione |
| SMILES | Cc1ccc2c(c1)C[C@@]1(CN2C)C(=O)NC(=O)N(c2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C24H21N3O3/c1-15-10-11-19-17(12-15)13-24(14-26(19)2)21(28)25-23(30)27(22(24)29)20-9-5-7-16-6-3-4-8-18(16)20/h3-12H,13-14H2,1-2H3,(H,25,28,30)/t24-/m1/s1 |
| InChIKey | SDKITPVRUVCUKQ-XMMPIXPASA-N |
| XLogP | 3.41 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|