About 4-(bromomethyl)-6-(4-methoxyphenyl)-3-methyl-5-nitro-1,6-dihydropyrimidin-2-one
4-(bromomethyl)-6-(4-methoxyphenyl)-3-methyl-5-nitro-1,6-dihydropyrimidin-2-one (PubChem CID 139230095) has the molecular formula C13H14BrN3O4
and a molecular weight of 356.18 g/mol. Its IUPAC name is 4-(bromomethyl)-6-(4-methoxyphenyl)-3-methyl-5-nitro-1,6-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 4-(bromomethyl)-6-(4-methoxyphenyl)-3-methyl-5-nitro-1,6-dihydropyrimidin-2-one |
| PubChem CID | 139230095 |
| Molecular Formula | C13H14BrN3O4 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 4-(bromomethyl)-6-(4-methoxyphenyl)-3-methyl-5-nitro-1,6-dihydropyrimidin-2-one |
| SMILES | COc1ccc(C2NC(=O)N(C)C(CBr)=C2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H14BrN3O4/c1-16-10(7-14)12(17(19)20)11(15-13(16)18)8-3-5-9(21-2)6-4-8/h3-6,11H,7H2,1-2H3,(H,15,18) |
| InChIKey | KEWHVLKPYOSBIV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)-6-(4-methoxyphenyl)-3-methyl-5-nitro-1,6-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)-6-(4-methoxyphenyl)-3-methyl-5-nitro-1,6-dihydropyrimidin-2-one?
The IUPAC name of 4-(bromomethyl)-6-(4-methoxyphenyl)-3-methyl-5-nitro-1,6-dihydropyrimidin-2-one (CID 139230095) is 4-(bromomethyl)-6-(4-methoxyphenyl)-3-methyl-5-nitro-1,6-dihydropyrimidin-2-one.
What is the SMILES notation for 4-(bromomethyl)-6-(4-methoxyphenyl)-3-methyl-5-nitro-1,6-dihydropyrimidin-2-one?
The canonical SMILES for 4-(bromomethyl)-6-(4-methoxyphenyl)-3-methyl-5-nitro-1,6-dihydropyrimidin-2-one is COc1ccc(C2NC(=O)N(C)C(CBr)=C2[N+](=O)[O-])cc1.
What is the InChIKey of 4-(bromomethyl)-6-(4-methoxyphenyl)-3-methyl-5-nitro-1,6-dihydropyrimidin-2-one?
The InChIKey is KEWHVLKPYOSBIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrN3O4/c1-16-10(7-14)12(17(19)20)11(15-13(16)18)8-3-5-9(21-2)6-4-8/h3-6,11H,7H2,1-2H3,(H,15,18).
What are the key properties of 4-(bromomethyl)-6-(4-methoxyphenyl)-3-methyl-5-nitro-1,6-dihydropyrimidin-2-one?
4-(bromomethyl)-6-(4-methoxyphenyl)-3-methyl-5-nitro-1,6-dihydropyrimidin-2-one has a molecular weight of 356.18 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)-6-(4-methoxyphenyl)-3-methyl-5-nitro-1,6-dihydropyrimidin-2-one is sourced from PubChem (CID 139230095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).