C11H14N4 — CID 139230155
3-cyclohexyl-[1,2,4]triazolo[4,3-a]pyrimidine (PubChem CID 139230155) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-cyclohexyl-[1,2,4]triazolo[4,3-a]pyrimidine.
| Compound Name | 3-cyclohexyl-[1,2,4]triazolo[4,3-a]pyrimidine |
|---|---|
| PubChem CID | 139230155 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 3-cyclohexyl-[1,2,4]triazolo[4,3-a]pyrimidine |
| SMILES | c1cnc2nnc(C3CCCCC3)n2c1 |
| InChI | InChI=1S/C11H14N4/c1-2-5-9(6-3-1)10-13-14-11-12-7-4-8-15(10)11/h4,7-9H,1-3,5-6H2 |
| InChIKey | DABZDAHIXCCJPF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |