About 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrimidine
3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrimidine (PubChem CID 139230156) has the molecular formula C8H8N4
and a molecular weight of 160.18 g/mol. Its IUPAC name is 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrimidine.
Molecular Properties
| Compound Name | 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrimidine |
| PubChem CID | 139230156 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrimidine |
| SMILES | c1cnc2nnc(C3CC3)n2c1 |
| InChI | InChI=1S/C8H8N4/c1-4-9-8-11-10-7(6-2-3-6)12(8)5-1/h1,4-6H,2-3H2 |
| InChIKey | XCSJINXSLGOIOZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrimidine?
The IUPAC name of 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrimidine (CID 139230156) is 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrimidine.
What is the SMILES notation for 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrimidine?
The canonical SMILES for 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrimidine is c1cnc2nnc(C3CC3)n2c1.
What is the InChIKey of 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrimidine?
The InChIKey is XCSJINXSLGOIOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4/c1-4-9-8-11-10-7(6-2-3-6)12(8)5-1/h1,4-6H,2-3H2.
What are the key properties of 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrimidine?
3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrimidine has a molecular weight of 160.18 g/mol, XLogP of 1.00, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrimidine is sourced from PubChem (CID 139230156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).