About N-(4,5-diethyl-1H-imidazol-2-yl)acetamide
N-(4,5-diethyl-1H-imidazol-2-yl)acetamide (PubChem CID 139230303) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is N-(4,5-diethyl-1H-imidazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(4,5-diethyl-1H-imidazol-2-yl)acetamide |
| PubChem CID | 139230303 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | N-(4,5-diethyl-1H-imidazol-2-yl)acetamide |
| SMILES | CCc1nc(NC(C)=O)[nH]c1CC |
| InChI | InChI=1S/C9H15N3O/c1-4-7-8(5-2)12-9(11-7)10-6(3)13/h4-5H2,1-3H3,(H2,10,11,12,13) |
| InChIKey | JYYJRCYITVMIOJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4,5-diethyl-1H-imidazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-diethyl-1H-imidazol-2-yl)acetamide?
The IUPAC name of N-(4,5-diethyl-1H-imidazol-2-yl)acetamide (CID 139230303) is N-(4,5-diethyl-1H-imidazol-2-yl)acetamide.
What is the SMILES notation for N-(4,5-diethyl-1H-imidazol-2-yl)acetamide?
The canonical SMILES for N-(4,5-diethyl-1H-imidazol-2-yl)acetamide is CCc1nc(NC(C)=O)[nH]c1CC.
What is the InChIKey of N-(4,5-diethyl-1H-imidazol-2-yl)acetamide?
The InChIKey is JYYJRCYITVMIOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-4-7-8(5-2)12-9(11-7)10-6(3)13/h4-5H2,1-3H3,(H2,10,11,12,13).
What are the key properties of N-(4,5-diethyl-1H-imidazol-2-yl)acetamide?
N-(4,5-diethyl-1H-imidazol-2-yl)acetamide has a molecular weight of 181.24 g/mol, XLogP of 1.49, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-diethyl-1H-imidazol-2-yl)acetamide is sourced from PubChem (CID 139230303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).