About 1-benzyl-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide
1-benzyl-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide (PubChem CID 139230428) has the molecular formula C25H22BrN3O
and a molecular weight of 460.38 g/mol. Its IUPAC name is 1-benzyl-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide.
Molecular Properties
| Compound Name | 1-benzyl-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide |
| PubChem CID | 139230428 |
| Molecular Formula | C25H22BrN3O |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 1-benzyl-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide |
| SMILES | OC1(c2ccccc2)C(c2ccccc2)[n+]2cccnc2N1Cc1ccccc1.[Br-] |
| InChI | InChI=1S/C25H22N3O.BrH/c29-25(22-15-8-3-9-16-22)23(21-13-6-2-7-14-21)27-18-10-17-26-24(27)28(25)19-20-11-4-1-5-12-20;/h1-18,23,29H,19H2;1H/q+1;/p-1 |
| InChIKey | RLLAEBDYKBPVAZ-UHFFFAOYSA-M |
| XLogP | 0.83 |
| TPSA | 40.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide?
The IUPAC name of 1-benzyl-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide (CID 139230428) is 1-benzyl-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide.
What is the SMILES notation for 1-benzyl-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide?
The canonical SMILES for 1-benzyl-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide is OC1(c2ccccc2)C(c2ccccc2)[n+]2cccnc2N1Cc1ccccc1.[Br-].
What is the InChIKey of 1-benzyl-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide?
The InChIKey is RLLAEBDYKBPVAZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C25H22N3O.BrH/c29-25(22-15-8-3-9-16-22)23(21-13-6-2-7-14-21)27-18-10-17-26-24(27)28(25)19-20-11-4-1-5-12-20;/h1-18,23,29H,19H2;1H/q+1;/p-1.
What are the key properties of 1-benzyl-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide?
1-benzyl-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide has a molecular weight of 460.38 g/mol, XLogP of 0.83, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2,3-diphenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide is sourced from PubChem (CID 139230428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).