C23H39NO3Si2 — CID 139231177
4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5,6-dimethyl-1H-indole-2-carbaldehyde (PubChem CID 139231177) has the molecular formula C23H39NO3Si2 and a molecular weight of 433.74 g/mol. Its IUPAC name is 4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5,6-dimethyl-1H-indole-2-carbaldehyde.
| Compound Name | 4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5,6-dimethyl-1H-indole-2-carbaldehyde |
|---|---|
| PubChem CID | 139231177 |
| Molecular Formula | C23H39NO3Si2 |
| Molecular Weight | 433.74 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5,6-dimethyl-1H-indole-2-carbaldehyde |
| SMILES | Cc1c(C)c(O[Si](C)(C)C(C)(C)C)c2[nH]c(C=O)cc2c1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H39NO3Si2/c1-15-16(2)21(27-29(11,12)23(6,7)8)19-18(13-17(14-25)24-19)20(15)26-28(9,10)22(3,4)5/h13-14,24H,1-12H3 |
| InChIKey | ZMLXZNWIEZXSOL-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.74 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|