C30H33O4P — CID 139231201
[1,4-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxobut-2-en-2-yl]-triphenylphosphanium (PubChem CID 139231201) has the molecular formula C30H33O4P and a molecular weight of 488.56 g/mol. Its IUPAC name is [1,4-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxobut-2-en-2-yl]-triphenylphosphanium.
| Compound Name | [1,4-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxobut-2-en-2-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 139231201 |
| Molecular Formula | C30H33O4P |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | [1,4-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxobut-2-en-2-yl]-triphenylphosphanium |
| SMILES | CC(C)(C)OC(=O)/[C-]=C(\C(=O)OC(C)(C)C)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H33O4P/c1-29(2,3)33-27(31)22-26(28(32)34-30(4,5)6)35(23-16-10-7-11-17-23,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-21H,1-6H3 |
| InChIKey | QQXRFFYKUPSERL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|