C18H21NO4 — CID 139231242
ethyl (10S,14R)-4,12,12-trimethyl-11,13-dioxa-1-azatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraene-8-carboxylate (PubChem CID 139231242) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is ethyl (10S,14R)-4,12,12-trimethyl-11,13-dioxa-1-azatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraene-8-carboxylate.
| Compound Name | ethyl (10S,14R)-4,12,12-trimethyl-11,13-dioxa-1-azatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraene-8-carboxylate |
|---|---|
| PubChem CID | 139231242 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | ethyl (10S,14R)-4,12,12-trimethyl-11,13-dioxa-1-azatetracyclo[7.6.0.02,7.010,14]pentadeca-2(7),3,5,8-tetraene-8-carboxylate |
| SMILES | CCOC(=O)c1c2n(c3cc(C)ccc13)C[C@H]1OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C18H21NO4/c1-5-21-17(20)14-11-7-6-10(2)8-12(11)19-9-13-16(15(14)19)23-18(3,4)22-13/h6-8,13,16H,5,9H2,1-4H3/t13-,16-/m1/s1 |
| InChIKey | KCDMMYJWRJQQOP-CZUORRHYSA-N |
| XLogP | 3.33 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |