C17H19ClF3NO3 — CID 139231366
ethyl 4-[2-(tert-butylamino)-5-chlorophenyl]-5,5,5-trifluoro-4-hydroxypent-2-ynoate (PubChem CID 139231366) has the molecular formula C17H19ClF3NO3 and a molecular weight of 377.79 g/mol. Its IUPAC name is ethyl 4-[2-(tert-butylamino)-5-chlorophenyl]-5,5,5-trifluoro-4-hydroxypent-2-ynoate.
| Compound Name | ethyl 4-[2-(tert-butylamino)-5-chlorophenyl]-5,5,5-trifluoro-4-hydroxypent-2-ynoate |
|---|---|
| PubChem CID | 139231366 |
| Molecular Formula | C17H19ClF3NO3 |
| Molecular Weight | 377.79 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | ethyl 4-[2-(tert-butylamino)-5-chlorophenyl]-5,5,5-trifluoro-4-hydroxypent-2-ynoate |
| SMILES | CCOC(=O)C#CC(O)(c1cc(Cl)ccc1NC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C17H19ClF3NO3/c1-5-25-14(23)8-9-16(24,17(19,20)21)12-10-11(18)6-7-13(12)22-15(2,3)4/h6-7,10,22,24H,5H2,1-4H3 |
| InChIKey | FHGIDNYXUYLBTC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.79 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|