C27H21ClN2O3 — CID 139231566
6-(4-chlorophenyl)-7-(2-hydroxyphenyl)-2,3,4,9,10,11-hexahydroindolo[1,2-a]quinoxaline-1,8-dione (PubChem CID 139231566) has the molecular formula C27H21ClN2O3 and a molecular weight of 456.93 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-7-(2-hydroxyphenyl)-2,3,4,9,10,11-hexahydroindolo[1,2-a]quinoxaline-1,8-dione.
| Compound Name | 6-(4-chlorophenyl)-7-(2-hydroxyphenyl)-2,3,4,9,10,11-hexahydroindolo[1,2-a]quinoxaline-1,8-dione |
|---|---|
| PubChem CID | 139231566 |
| Molecular Formula | C27H21ClN2O3 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 6-(4-chlorophenyl)-7-(2-hydroxyphenyl)-2,3,4,9,10,11-hexahydroindolo[1,2-a]quinoxaline-1,8-dione |
| SMILES | O=C1CCCc2c1c(-c1ccccc1O)c1c(-c3ccc(Cl)cc3)nc3c(n21)C(=O)CCC3 |
| InChI | InChI=1S/C27H21ClN2O3/c28-16-13-11-15(12-14-16)25-27-23(17-5-1-2-8-20(17)31)24-19(7-4-9-21(24)32)30(27)26-18(29-25)6-3-10-22(26)33/h1-2,5,8,11-14,31H,3-4,6-7,9-10H2 |
| InChIKey | WRILXTMNSDYWOY-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |