C19H18ClN5O2S — CID 139231652
2-[3-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1-(3,4-dimethoxyphenyl)ethanamine (PubChem CID 139231652) has the molecular formula C19H18ClN5O2S and a molecular weight of 415.91 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1-(3,4-dimethoxyphenyl)ethanamine.
| Compound Name | 2-[3-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1-(3,4-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 139231652 |
| Molecular Formula | C19H18ClN5O2S |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1-(3,4-dimethoxyphenyl)ethanamine |
| SMILES | COc1ccc(C(N)Cc2nn3c(-c4ccc(Cl)cc4)nnc3s2)cc1OC |
| InChI | InChI=1S/C19H18ClN5O2S/c1-26-15-8-5-12(9-16(15)27-2)14(21)10-17-24-25-18(22-23-19(25)28-17)11-3-6-13(20)7-4-11/h3-9,14H,10,21H2,1-2H3 |
| InChIKey | NSMPMRUUZDCOFS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |