C15H11N7S — CID 139231671
4-amino-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,3-thiazine-5,6,6-tricarbonitrile (PubChem CID 139231671) has the molecular formula C15H11N7S and a molecular weight of 321.37 g/mol. Its IUPAC name is 4-amino-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,3-thiazine-5,6,6-tricarbonitrile.
| Compound Name | 4-amino-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,3-thiazine-5,6,6-tricarbonitrile |
|---|---|
| PubChem CID | 139231671 |
| Molecular Formula | C15H11N7S |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 4-amino-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]-1,3-thiazine-5,6,6-tricarbonitrile |
| SMILES | C/C(=N\NC1=NC(N)=C(C#N)C(C#N)(C#N)S1)c1ccccc1 |
| InChI | InChI=1S/C15H11N7S/c1-10(11-5-3-2-4-6-11)21-22-14-20-13(19)12(7-16)15(8-17,9-18)23-14/h2-6H,19H2,1H3,(H,20,22)/b21-10+ |
| InChIKey | AOFFPSWLAVYAEB-UFFVCSGVSA-N |
| XLogP | 1.58 |
| TPSA | 134.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|