About 4-but-3-enyl-2-oxido-3-phenyl-1,2,5-oxadiazol-2-ium
4-but-3-enyl-2-oxido-3-phenyl-1,2,5-oxadiazol-2-ium (PubChem CID 139231876) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-but-3-enyl-2-oxido-3-phenyl-1,2,5-oxadiazol-2-ium.
Molecular Properties
| Compound Name | 4-but-3-enyl-2-oxido-3-phenyl-1,2,5-oxadiazol-2-ium |
| PubChem CID | 139231876 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 4-but-3-enyl-2-oxido-3-phenyl-1,2,5-oxadiazol-2-ium |
| SMILES | C=CCCc1no[n+]([O-])c1-c1ccccc1 |
| InChI | InChI=1S/C12H12N2O2/c1-2-3-9-11-12(14(15)16-13-11)10-7-5-4-6-8-10/h2,4-8H,1,3,9H2 |
| InChIKey | MDMFCUUIQZKKQX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-enyl-2-oxido-3-phenyl-1,2,5-oxadiazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-enyl-2-oxido-3-phenyl-1,2,5-oxadiazol-2-ium?
The IUPAC name of 4-but-3-enyl-2-oxido-3-phenyl-1,2,5-oxadiazol-2-ium (CID 139231876) is 4-but-3-enyl-2-oxido-3-phenyl-1,2,5-oxadiazol-2-ium.
What is the SMILES notation for 4-but-3-enyl-2-oxido-3-phenyl-1,2,5-oxadiazol-2-ium?
The canonical SMILES for 4-but-3-enyl-2-oxido-3-phenyl-1,2,5-oxadiazol-2-ium is C=CCCc1no[n+]([O-])c1-c1ccccc1.
What is the InChIKey of 4-but-3-enyl-2-oxido-3-phenyl-1,2,5-oxadiazol-2-ium?
The InChIKey is MDMFCUUIQZKKQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c1-2-3-9-11-12(14(15)16-13-11)10-7-5-4-6-8-10/h2,4-8H,1,3,9H2.
What are the key properties of 4-but-3-enyl-2-oxido-3-phenyl-1,2,5-oxadiazol-2-ium?
4-but-3-enyl-2-oxido-3-phenyl-1,2,5-oxadiazol-2-ium has a molecular weight of 216.24 g/mol, XLogP of 2.09, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-enyl-2-oxido-3-phenyl-1,2,5-oxadiazol-2-ium is sourced from PubChem (CID 139231876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).