C39H31N7O4 — CID 139232034
3-[6-[5,6-bis(3-methoxyphenyl)-1,2,4-triazin-3-yl]-2-pyridinyl]-5,6-bis(3-methoxyphenyl)-1,2,4-triazine (PubChem CID 139232034) has the molecular formula C39H31N7O4 and a molecular weight of 661.72 g/mol. Its IUPAC name is 3-[6-[5,6-bis(3-methoxyphenyl)-1,2,4-triazin-3-yl]-2-pyridinyl]-5,6-bis(3-methoxyphenyl)-1,2,4-triazine.
| Compound Name | 3-[6-[5,6-bis(3-methoxyphenyl)-1,2,4-triazin-3-yl]-2-pyridinyl]-5,6-bis(3-methoxyphenyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 139232034 |
| Molecular Formula | C39H31N7O4 |
| Molecular Weight | 661.72 g/mol |
| Exact Mass | 661.24 |
| IUPAC Name | 3-[6-[5,6-bis(3-methoxyphenyl)-1,2,4-triazin-3-yl]-2-pyridinyl]-5,6-bis(3-methoxyphenyl)-1,2,4-triazine |
| SMILES | COc1cccc(-c2nnc(-c3cccc(-c4nnc(-c5cccc(OC)c5)c(-c5cccc(OC)c5)n4)n3)nc2-c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C39H31N7O4/c1-47-28-14-5-10-24(20-28)34-36(26-12-7-16-30(22-26)49-3)43-45-38(41-34)32-18-9-19-33(40-32)39-42-35(25-11-6-15-29(21-25)48-2)37(44-46-39)27-13-8-17-31(23-27)50-4/h5-23H,1-4H3 |
| InChIKey | MUCNRPTUZYTYNI-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 127.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.72 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |