C24H17N5O3S — CID 139232350
(2E)-2-cyano-N-[3-cyano-4-(furan-2-yl)-5,6-dimethyl-2-pyridinyl]-2-(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)acetamide (PubChem CID 139232350) has the molecular formula C24H17N5O3S and a molecular weight of 455.50 g/mol. Its IUPAC name is (2E)-2-cyano-N-[3-cyano-4-(furan-2-yl)-5,6-dimethyl-2-pyridinyl]-2-(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)acetamide.
| Compound Name | (2E)-2-cyano-N-[3-cyano-4-(furan-2-yl)-5,6-dimethyl-2-pyridinyl]-2-(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)acetamide |
|---|---|
| PubChem CID | 139232350 |
| Molecular Formula | C24H17N5O3S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | (2E)-2-cyano-N-[3-cyano-4-(furan-2-yl)-5,6-dimethyl-2-pyridinyl]-2-(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)acetamide |
| SMILES | Cc1nc(NC(=O)/C(C#N)=C2/SCC(=O)N2c2ccccc2)c(C#N)c(-c2ccco2)c1C |
| InChI | InChI=1S/C24H17N5O3S/c1-14-15(2)27-22(17(11-25)21(14)19-9-6-10-32-19)28-23(31)18(12-26)24-29(20(30)13-33-24)16-7-4-3-5-8-16/h3-10H,13H2,1-2H3,(H,27,28,31)/b24-18+ |
| InChIKey | LJJAUANXZUEHTF-HKOYGPOVSA-N |
| XLogP | 4.28 |
| TPSA | 123.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|