C14H16N4O4 — CID 139232384
2-amino-N-[(3S)-5-methyl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]acetamide (PubChem CID 139232384) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-amino-N-[(3S)-5-methyl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]acetamide.
| Compound Name | 2-amino-N-[(3S)-5-methyl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]acetamide |
|---|---|
| PubChem CID | 139232384 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-amino-N-[(3S)-5-methyl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]acetamide |
| SMILES | CN1C(=O)C2ON(c3ccccc3)[C@H](NC(=O)CN)C2C1=O |
| InChI | InChI=1S/C14H16N4O4/c1-17-13(20)10-11(14(17)21)22-18(8-5-3-2-4-6-8)12(10)16-9(19)7-15/h2-6,10-12H,7,15H2,1H3,(H,16,19)/t10?,11?,12-/m0/s1 |
| InChIKey | MLUPOMYEDSHSGY-MCIGGMRASA-N |
| XLogP | -1.18 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|