C14H16N4O4S2 — CID 139232676
2-(2-hydrazinyl-2-oxoethyl)sulfonyl-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 139232676) has the molecular formula C14H16N4O4S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-(2-hydrazinyl-2-oxoethyl)sulfonyl-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(2-hydrazinyl-2-oxoethyl)sulfonyl-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 139232676 |
| Molecular Formula | C14H16N4O4S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 2-(2-hydrazinyl-2-oxoethyl)sulfonyl-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)CS(=O)(=O)CC(=O)NN)n2)cc1 |
| InChI | InChI=1S/C14H16N4O4S2/c1-9-2-4-10(5-3-9)11-6-23-14(16-11)17-12(19)7-24(21,22)8-13(20)18-15/h2-6H,7-8,15H2,1H3,(H,18,20)(H,16,17,19) |
| InChIKey | RQMBPVIXDPLBHL-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|