About 3-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one
3-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one (PubChem CID 139232812) has the molecular formula C12H10N4OS2
and a molecular weight of 290.37 g/mol. Its IUPAC name is 3-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one |
| PubChem CID | 139232812 |
| Molecular Formula | C12H10N4OS2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 3-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SCC(=O)N1c1nc(-c2ccc(N)cc2)cs1 |
| InChI | InChI=1S/C12H10N4OS2/c13-8-3-1-7(2-4-8)9-5-19-12(15-9)16-10(17)6-18-11(16)14/h1-5,14H,6,13H2/b14-11- |
| InChIKey | CPCMQXXMVCDHMH-KAMYIIQDSA-N |
| XLogP | 2.41 |
| TPSA | 83.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one?
The IUPAC name of 3-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one (CID 139232812) is 3-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one?
The canonical SMILES for 3-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one is [H]/N=C1\SCC(=O)N1c1nc(-c2ccc(N)cc2)cs1.
What is the InChIKey of 3-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one?
The InChIKey is CPCMQXXMVCDHMH-KAMYIIQDSA-N. The full InChI is InChI=1S/C12H10N4OS2/c13-8-3-1-7(2-4-8)9-5-19-12(15-9)16-10(17)6-18-11(16)14/h1-5,14H,6,13H2/b14-11-.
What are the key properties of 3-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one?
3-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one has a molecular weight of 290.37 g/mol, XLogP of 2.41, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-imino-1,3-thiazolidin-4-one is sourced from PubChem (CID 139232812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).