About 6,8-bis(4-fluorophenyl)-2,4-diphenylfuro[3,2-c]quinoline
6,8-bis(4-fluorophenyl)-2,4-diphenylfuro[3,2-c]quinoline (PubChem CID 139232877) has the molecular formula C35H21F2NO
and a molecular weight of 509.56 g/mol. Its IUPAC name is 6,8-bis(4-fluorophenyl)-2,4-diphenylfuro[3,2-c]quinoline.
Molecular Properties
| Compound Name | 6,8-bis(4-fluorophenyl)-2,4-diphenylfuro[3,2-c]quinoline |
| PubChem CID | 139232877 |
| Molecular Formula | C35H21F2NO |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 6,8-bis(4-fluorophenyl)-2,4-diphenylfuro[3,2-c]quinoline |
| SMILES | Fc1ccc(-c2cc(-c3ccc(F)cc3)c3nc(-c4ccccc4)c4cc(-c5ccccc5)oc4c3c2)cc1 |
| InChI | InChI=1S/C35H21F2NO/c36-27-15-11-22(12-16-27)26-19-29(23-13-17-28(37)18-14-23)34-30(20-26)35-31(33(38-34)25-9-5-2-6-10-25)21-32(39-35)24-7-3-1-4-8-24/h1-21H |
| InChIKey | APFKERQARVBXQR-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,8-bis(4-fluorophenyl)-2,4-diphenylfuro[3,2-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-bis(4-fluorophenyl)-2,4-diphenylfuro[3,2-c]quinoline?
The IUPAC name of 6,8-bis(4-fluorophenyl)-2,4-diphenylfuro[3,2-c]quinoline (CID 139232877) is 6,8-bis(4-fluorophenyl)-2,4-diphenylfuro[3,2-c]quinoline.
What is the SMILES notation for 6,8-bis(4-fluorophenyl)-2,4-diphenylfuro[3,2-c]quinoline?
The canonical SMILES for 6,8-bis(4-fluorophenyl)-2,4-diphenylfuro[3,2-c]quinoline is Fc1ccc(-c2cc(-c3ccc(F)cc3)c3nc(-c4ccccc4)c4cc(-c5ccccc5)oc4c3c2)cc1.
What is the InChIKey of 6,8-bis(4-fluorophenyl)-2,4-diphenylfuro[3,2-c]quinoline?
The InChIKey is APFKERQARVBXQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H21F2NO/c36-27-15-11-22(12-16-27)26-19-29(23-13-17-28(37)18-14-23)34-30(20-26)35-31(33(38-34)25-9-5-2-6-10-25)21-32(39-35)24-7-3-1-4-8-24/h1-21H.
What are the key properties of 6,8-bis(4-fluorophenyl)-2,4-diphenylfuro[3,2-c]quinoline?
6,8-bis(4-fluorophenyl)-2,4-diphenylfuro[3,2-c]quinoline has a molecular weight of 509.56 g/mol, XLogP of 9.93, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-bis(4-fluorophenyl)-2,4-diphenylfuro[3,2-c]quinoline is sourced from PubChem (CID 139232877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).