About 4-(4-chlorophenyl)-6,8-bis(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline
4-(4-chlorophenyl)-6,8-bis(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline (PubChem CID 139232879) has the molecular formula C35H20ClF2NO
and a molecular weight of 544.00 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-6,8-bis(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-6,8-bis(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline |
| PubChem CID | 139232879 |
| Molecular Formula | C35H20ClF2NO |
| Molecular Weight | 544.00 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | 4-(4-chlorophenyl)-6,8-bis(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline |
| SMILES | Fc1ccc(-c2cc(-c3ccc(F)cc3)c3nc(-c4ccc(Cl)cc4)c4cc(-c5ccccc5)oc4c3c2)cc1 |
| InChI | InChI=1S/C35H20ClF2NO/c36-26-12-6-24(7-13-26)33-31-20-32(23-4-2-1-3-5-23)40-35(31)30-19-25(21-8-14-27(37)15-9-21)18-29(34(30)39-33)22-10-16-28(38)17-11-22/h1-20H |
| InChIKey | ZLTRIGUKKCCKAB-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.00 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-chlorophenyl)-6,8-bis(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-6,8-bis(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline?
The IUPAC name of 4-(4-chlorophenyl)-6,8-bis(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline (CID 139232879) is 4-(4-chlorophenyl)-6,8-bis(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline.
What is the SMILES notation for 4-(4-chlorophenyl)-6,8-bis(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline?
The canonical SMILES for 4-(4-chlorophenyl)-6,8-bis(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline is Fc1ccc(-c2cc(-c3ccc(F)cc3)c3nc(-c4ccc(Cl)cc4)c4cc(-c5ccccc5)oc4c3c2)cc1.
What is the InChIKey of 4-(4-chlorophenyl)-6,8-bis(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline?
The InChIKey is ZLTRIGUKKCCKAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H20ClF2NO/c36-26-12-6-24(7-13-26)33-31-20-32(23-4-2-1-3-5-23)40-35(31)30-19-25(21-8-14-27(37)15-9-21)18-29(34(30)39-33)22-10-16-28(38)17-11-22/h1-20H.
What are the key properties of 4-(4-chlorophenyl)-6,8-bis(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline?
4-(4-chlorophenyl)-6,8-bis(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline has a molecular weight of 544.00 g/mol, XLogP of 10.58, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-6,8-bis(4-fluorophenyl)-2-phenylfuro[3,2-c]quinoline is sourced from PubChem (CID 139232879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).