About 6,8-bis(4-fluorophenyl)-4-(4-methoxyphenyl)-2-phenylfuro[3,2-c]quinoline
6,8-bis(4-fluorophenyl)-4-(4-methoxyphenyl)-2-phenylfuro[3,2-c]quinoline (PubChem CID 139232880) has the molecular formula C36H23F2NO2
and a molecular weight of 539.58 g/mol. Its IUPAC name is 6,8-bis(4-fluorophenyl)-4-(4-methoxyphenyl)-2-phenylfuro[3,2-c]quinoline.
Molecular Properties
| Compound Name | 6,8-bis(4-fluorophenyl)-4-(4-methoxyphenyl)-2-phenylfuro[3,2-c]quinoline |
| PubChem CID | 139232880 |
| Molecular Formula | C36H23F2NO2 |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 6,8-bis(4-fluorophenyl)-4-(4-methoxyphenyl)-2-phenylfuro[3,2-c]quinoline |
| SMILES | COc1ccc(-c2nc3c(-c4ccc(F)cc4)cc(-c4ccc(F)cc4)cc3c3oc(-c4ccccc4)cc23)cc1 |
| InChI | InChI=1S/C36H23F2NO2/c1-40-29-17-11-25(12-18-29)34-32-21-33(24-5-3-2-4-6-24)41-36(32)31-20-26(22-7-13-27(37)14-8-22)19-30(35(31)39-34)23-9-15-28(38)16-10-23/h2-21H,1H3 |
| InChIKey | CIXJZJLGACRTBD-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-bis(4-fluorophenyl)-4-(4-methoxyphenyl)-2-phenylfuro[3,2-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-bis(4-fluorophenyl)-4-(4-methoxyphenyl)-2-phenylfuro[3,2-c]quinoline?
The IUPAC name of 6,8-bis(4-fluorophenyl)-4-(4-methoxyphenyl)-2-phenylfuro[3,2-c]quinoline (CID 139232880) is 6,8-bis(4-fluorophenyl)-4-(4-methoxyphenyl)-2-phenylfuro[3,2-c]quinoline.
What is the SMILES notation for 6,8-bis(4-fluorophenyl)-4-(4-methoxyphenyl)-2-phenylfuro[3,2-c]quinoline?
The canonical SMILES for 6,8-bis(4-fluorophenyl)-4-(4-methoxyphenyl)-2-phenylfuro[3,2-c]quinoline is COc1ccc(-c2nc3c(-c4ccc(F)cc4)cc(-c4ccc(F)cc4)cc3c3oc(-c4ccccc4)cc23)cc1.
What is the InChIKey of 6,8-bis(4-fluorophenyl)-4-(4-methoxyphenyl)-2-phenylfuro[3,2-c]quinoline?
The InChIKey is CIXJZJLGACRTBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H23F2NO2/c1-40-29-17-11-25(12-18-29)34-32-21-33(24-5-3-2-4-6-24)41-36(32)31-20-26(22-7-13-27(37)14-8-22)19-30(35(31)39-34)23-9-15-28(38)16-10-23/h2-21H,1H3.
What are the key properties of 6,8-bis(4-fluorophenyl)-4-(4-methoxyphenyl)-2-phenylfuro[3,2-c]quinoline?
6,8-bis(4-fluorophenyl)-4-(4-methoxyphenyl)-2-phenylfuro[3,2-c]quinoline has a molecular weight of 539.58 g/mol, XLogP of 9.94, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-bis(4-fluorophenyl)-4-(4-methoxyphenyl)-2-phenylfuro[3,2-c]quinoline is sourced from PubChem (CID 139232880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).