C17H16O4 — CID 139232998
methyl (1R,5S)-5,7-dimethyl-3-oxo-1-phenyl-4-oxatricyclo[3.3.0.02,8]oct-6-ene-2-carboxylate (PubChem CID 139232998) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is methyl (1R,5S)-5,7-dimethyl-3-oxo-1-phenyl-4-oxatricyclo[3.3.0.02,8]oct-6-ene-2-carboxylate.
| Compound Name | methyl (1R,5S)-5,7-dimethyl-3-oxo-1-phenyl-4-oxatricyclo[3.3.0.02,8]oct-6-ene-2-carboxylate |
|---|---|
| PubChem CID | 139232998 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | methyl (1R,5S)-5,7-dimethyl-3-oxo-1-phenyl-4-oxatricyclo[3.3.0.02,8]oct-6-ene-2-carboxylate |
| SMILES | COC(=O)C12C(=O)O[C@@]3(C)C=C(C)C1[C@@]23c1ccccc1 |
| InChI | InChI=1S/C17H16O4/c1-10-9-15(2)17(11-7-5-4-6-8-11)12(10)16(17,13(18)20-3)14(19)21-15/h4-9,12H,1-3H3/t12?,15-,16?,17+/m0/s1 |
| InChIKey | WLSXDVFJXUDARQ-FPLFOGFYSA-N |
| XLogP | 1.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|