C41H33NO2 — CID 139233377
1,2,4,14-tetramethyl-9-(9,9'-spirobi[fluorene]-2-yl)-3,15-dioxa-9-azatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraene (PubChem CID 139233377) has the molecular formula C41H33NO2 and a molecular weight of 571.72 g/mol. Its IUPAC name is 1,2,4,14-tetramethyl-9-(9,9'-spirobi[fluorene]-2-yl)-3,15-dioxa-9-azatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraene.
| Compound Name | 1,2,4,14-tetramethyl-9-(9,9'-spirobi[fluorene]-2-yl)-3,15-dioxa-9-azatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraene |
|---|---|
| PubChem CID | 139233377 |
| Molecular Formula | C41H33NO2 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | 1,2,4,14-tetramethyl-9-(9,9'-spirobi[fluorene]-2-yl)-3,15-dioxa-9-azatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraene |
| SMILES | CC1=CC2=C3CN(c4ccc5c(c4)C4(c6ccccc6-c6ccccc64)c4ccccc4-5)CC3=C3C=C(C)OC3(C)C2(C)O1 |
| InChI | InChI=1S/C41H33NO2/c1-24-19-36-31-22-42(23-32(31)37-20-25(2)44-40(37,4)39(36,3)43-24)26-17-18-30-29-13-7-10-16-35(29)41(38(30)21-26)33-14-8-5-11-27(33)28-12-6-9-15-34(28)41/h5-21H,22-23H2,1-4H3 |
| InChIKey | CJNHLLHXWVCQOV-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |