C15H9F3N2O2 — CID 139233534
2-(2,4,5-trifluoro-3-methoxyphenoxy)quinoxaline (PubChem CID 139233534) has the molecular formula C15H9F3N2O2 and a molecular weight of 306.24 g/mol. Its IUPAC name is 2-(2,4,5-trifluoro-3-methoxyphenoxy)quinoxaline.
| Compound Name | 2-(2,4,5-trifluoro-3-methoxyphenoxy)quinoxaline |
|---|---|
| PubChem CID | 139233534 |
| Molecular Formula | C15H9F3N2O2 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-(2,4,5-trifluoro-3-methoxyphenoxy)quinoxaline |
| SMILES | COc1c(F)c(F)cc(Oc2cnc3ccccc3n2)c1F |
| InChI | InChI=1S/C15H9F3N2O2/c1-21-15-13(17)8(16)6-11(14(15)18)22-12-7-19-9-4-2-3-5-10(9)20-12/h2-7H,1H3 |
| InChIKey | MALUZVBOFMNZMY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|