About 2-[(3-fluoro-2,6-dimethoxy-4-quinoxalin-2-yloxybenzoyl)amino]pentanedioic acid
2-[(3-fluoro-2,6-dimethoxy-4-quinoxalin-2-yloxybenzoyl)amino]pentanedioic acid (PubChem CID 139233539) has the molecular formula C22H20FN3O8
and a molecular weight of 473.41 g/mol. Its IUPAC name is 2-[(3-fluoro-2,6-dimethoxy-4-quinoxalin-2-yloxybenzoyl)amino]pentanedioic acid.
Molecular Properties
| Compound Name | 2-[(3-fluoro-2,6-dimethoxy-4-quinoxalin-2-yloxybenzoyl)amino]pentanedioic acid |
| PubChem CID | 139233539 |
| Molecular Formula | C22H20FN3O8 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 2-[(3-fluoro-2,6-dimethoxy-4-quinoxalin-2-yloxybenzoyl)amino]pentanedioic acid |
| SMILES | COc1cc(Oc2cnc3ccccc3n2)c(F)c(OC)c1C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H20FN3O8/c1-32-14-9-15(34-16-10-24-11-5-3-4-6-12(11)25-16)19(23)20(33-2)18(14)21(29)26-13(22(30)31)7-8-17(27)28/h3-6,9-10,13H,7-8H2,1-2H3,(H,26,29)(H,27,28)(H,30,31) |
| InChIKey | QOROEUPSDLHRKV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 157.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[(3-fluoro-2,6-dimethoxy-4-quinoxalin-2-yloxybenzoyl)amino]pentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-fluoro-2,6-dimethoxy-4-quinoxalin-2-yloxybenzoyl)amino]pentanedioic acid?
The IUPAC name of 2-[(3-fluoro-2,6-dimethoxy-4-quinoxalin-2-yloxybenzoyl)amino]pentanedioic acid (CID 139233539) is 2-[(3-fluoro-2,6-dimethoxy-4-quinoxalin-2-yloxybenzoyl)amino]pentanedioic acid.
What is the SMILES notation for 2-[(3-fluoro-2,6-dimethoxy-4-quinoxalin-2-yloxybenzoyl)amino]pentanedioic acid?
The canonical SMILES for 2-[(3-fluoro-2,6-dimethoxy-4-quinoxalin-2-yloxybenzoyl)amino]pentanedioic acid is COc1cc(Oc2cnc3ccccc3n2)c(F)c(OC)c1C(=O)NC(CCC(=O)O)C(=O)O.
What is the InChIKey of 2-[(3-fluoro-2,6-dimethoxy-4-quinoxalin-2-yloxybenzoyl)amino]pentanedioic acid?
The InChIKey is QOROEUPSDLHRKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20FN3O8/c1-32-14-9-15(34-16-10-24-11-5-3-4-6-12(11)25-16)19(23)20(33-2)18(14)21(29)26-13(22(30)31)7-8-17(27)28/h3-6,9-10,13H,7-8H2,1-2H3,(H,26,29)(H,27,28)(H,30,31).
What are the key properties of 2-[(3-fluoro-2,6-dimethoxy-4-quinoxalin-2-yloxybenzoyl)amino]pentanedioic acid?
2-[(3-fluoro-2,6-dimethoxy-4-quinoxalin-2-yloxybenzoyl)amino]pentanedioic acid has a molecular weight of 473.41 g/mol, XLogP of 2.63, 10 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-fluoro-2,6-dimethoxy-4-quinoxalin-2-yloxybenzoyl)amino]pentanedioic acid is sourced from PubChem (CID 139233539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).