C8H18N4S — CID 139233729
6-hexyl-1,2,4,5-tetrazinane-3-thione (PubChem CID 139233729) has the molecular formula C8H18N4S and a molecular weight of 202.33 g/mol. Its IUPAC name is 6-hexyl-1,2,4,5-tetrazinane-3-thione.
| Compound Name | 6-hexyl-1,2,4,5-tetrazinane-3-thione |
|---|---|
| PubChem CID | 139233729 |
| Molecular Formula | C8H18N4S |
| Molecular Weight | 202.33 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 6-hexyl-1,2,4,5-tetrazinane-3-thione |
| SMILES | CCCCCCC1NNC(=S)NN1 |
| InChI | InChI=1S/C8H18N4S/c1-2-3-4-5-6-7-9-11-8(13)12-10-7/h7,9-10H,2-6H2,1H3,(H2,11,12,13) |
| InChIKey | JYUXLBSAXFGSBN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_F(6)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|