About 2-[1'-(hydroxymethyl)-2,2-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-cyclobutane]-1'-yl]ethanol
2-[1'-(hydroxymethyl)-2,2-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-cyclobutane]-1'-yl]ethanol (PubChem CID 139233768) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-[1'-(hydroxymethyl)-2,2-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-cyclobutane]-1'-yl]ethanol.
Molecular Properties
| Compound Name | 2-[1'-(hydroxymethyl)-2,2-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-cyclobutane]-1'-yl]ethanol |
| PubChem CID | 139233768 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-[1'-(hydroxymethyl)-2,2-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-cyclobutane]-1'-yl]ethanol |
| SMILES | CC1(C)C2CCC(C2)C12CC(CO)(CCO)C2 |
| InChI | InChI=1S/C15H26O2/c1-13(2)11-3-4-12(7-11)15(13)8-14(9-15,10-17)5-6-16/h11-12,16-17H,3-10H2,1-2H3 |
| InChIKey | HWFBRBWXXTVHEB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1'-(hydroxymethyl)-2,2-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-cyclobutane]-1'-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1'-(hydroxymethyl)-2,2-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-cyclobutane]-1'-yl]ethanol?
The IUPAC name of 2-[1'-(hydroxymethyl)-2,2-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-cyclobutane]-1'-yl]ethanol (CID 139233768) is 2-[1'-(hydroxymethyl)-2,2-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-cyclobutane]-1'-yl]ethanol.
What is the SMILES notation for 2-[1'-(hydroxymethyl)-2,2-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-cyclobutane]-1'-yl]ethanol?
The canonical SMILES for 2-[1'-(hydroxymethyl)-2,2-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-cyclobutane]-1'-yl]ethanol is CC1(C)C2CCC(C2)C12CC(CO)(CCO)C2.
What is the InChIKey of 2-[1'-(hydroxymethyl)-2,2-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-cyclobutane]-1'-yl]ethanol?
The InChIKey is HWFBRBWXXTVHEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O2/c1-13(2)11-3-4-12(7-11)15(13)8-14(9-15,10-17)5-6-16/h11-12,16-17H,3-10H2,1-2H3.
What are the key properties of 2-[1'-(hydroxymethyl)-2,2-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-cyclobutane]-1'-yl]ethanol?
2-[1'-(hydroxymethyl)-2,2-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-cyclobutane]-1'-yl]ethanol has a molecular weight of 238.37 g/mol, XLogP of 2.58, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1'-(hydroxymethyl)-2,2-dimethylspiro[bicyclo[2.2.1]heptane-3,3'-cyclobutane]-1'-yl]ethanol is sourced from PubChem (CID 139233768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).