C17H21N3O2 — CID 139233823
2-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 139233823) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 2-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 139233823 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CN(C)c1ccc(/C=N/N2C(=O)C3CCCCC3C2=O)cc1 |
| InChI | InChI=1S/C17H21N3O2/c1-19(2)13-9-7-12(8-10-13)11-18-20-16(21)14-5-3-4-6-15(14)17(20)22/h7-11,14-15H,3-6H2,1-2H3/b18-11+ |
| InChIKey | PQULKOXYUBMTOE-WOJGMQOQSA-N |
| XLogP | 2.26 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|