C14H11ClN4O4 — CID 139234125
ethyl 1-(4-chlorophenyl)-5,7-dioxo-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxylate (PubChem CID 139234125) has the molecular formula C14H11ClN4O4 and a molecular weight of 334.72 g/mol. Its IUPAC name is ethyl 1-(4-chlorophenyl)-5,7-dioxo-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 1-(4-chlorophenyl)-5,7-dioxo-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 139234125 |
| Molecular Formula | C14H11ClN4O4 |
| Molecular Weight | 334.72 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | ethyl 1-(4-chlorophenyl)-5,7-dioxo-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccc(Cl)cc2)C2=NC(=O)CC(=O)N12 |
| InChI | InChI=1S/C14H11ClN4O4/c1-2-23-13(22)12-17-19(9-5-3-8(15)4-6-9)14-16-10(20)7-11(21)18(12)14/h3-6H,2,7H2,1H3 |
| InChIKey | VBVFHDJTDSZFTN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 91.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.72 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|