C17H10F15N3O — CID 139234285
5-(4-methoxyphenyl)-1-methyl-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,2,4-triazole (PubChem CID 139234285) has the molecular formula C17H10F15N3O and a molecular weight of 557.26 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-1-methyl-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,2,4-triazole.
| Compound Name | 5-(4-methoxyphenyl)-1-methyl-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 139234285 |
| Molecular Formula | C17H10F15N3O |
| Molecular Weight | 557.26 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | 5-(4-methoxyphenyl)-1-methyl-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,2,4-triazole |
| SMILES | COc1ccc(-c2nc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nn2C)cc1 |
| InChI | InChI=1S/C17H10F15N3O/c1-35-9(7-3-5-8(36-2)6-4-7)33-10(34-35)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)32/h3-6H,1-2H3 |
| InChIKey | OJYRSXFBBKNQLH-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.26 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|