C11H5F7N2O2 — CID 139234288
4-[5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 139234288) has the molecular formula C11H5F7N2O2 and a molecular weight of 330.16 g/mol. Its IUPAC name is 4-[5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-oxadiazol-3-yl]phenol.
| Compound Name | 4-[5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-oxadiazol-3-yl]phenol |
|---|---|
| PubChem CID | 139234288 |
| Molecular Formula | C11H5F7N2O2 |
| Molecular Weight | 330.16 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 4-[5-(1,1,2,2,3,3,3-heptafluoropropyl)-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | Oc1ccc(-c2noc(C(F)(F)C(F)(F)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C11H5F7N2O2/c12-9(13,10(14,15)11(16,17)18)8-19-7(20-22-8)5-1-3-6(21)4-2-5/h1-4,21H |
| InChIKey | VBIPCRZPNSQYNW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.16 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|