C43H37NO4 — CID 139234919
9-(3,4-dimethoxyphenyl)-10-naphthalen-1-yl-3,6-diphenyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 139234919) has the molecular formula C43H37NO4 and a molecular weight of 631.77 g/mol. Its IUPAC name is 9-(3,4-dimethoxyphenyl)-10-naphthalen-1-yl-3,6-diphenyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(3,4-dimethoxyphenyl)-10-naphthalen-1-yl-3,6-diphenyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 139234919 |
| Molecular Formula | C43H37NO4 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | 9-(3,4-dimethoxyphenyl)-10-naphthalen-1-yl-3,6-diphenyl-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | COc1ccc(C2C3=C(CC(c4ccccc4)CC3=O)N(c3cccc4ccccc34)C3=C2C(=O)CC(c2ccccc2)C3)cc1OC |
| InChI | InChI=1S/C43H37NO4/c1-47-39-21-20-30(26-40(39)48-2)41-42-35(22-31(24-37(42)45)27-12-5-3-6-13-27)44(34-19-11-17-29-16-9-10-18-33(29)34)36-23-32(25-38(46)43(36)41)28-14-7-4-8-15-28/h3-21,26,31-32,41H,22-25H2,1-2H3 |
| InChIKey | ZKLBMMAMPQOFHT-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |