About methyl (3S)-3-(2,6-difluorophenyl)-2-methyl-3H-1,2-oxazole-5-carboxylate
methyl (3S)-3-(2,6-difluorophenyl)-2-methyl-3H-1,2-oxazole-5-carboxylate (PubChem CID 139234931) has the molecular formula C12H11F2NO3
and a molecular weight of 255.22 g/mol. Its IUPAC name is methyl (3S)-3-(2,6-difluorophenyl)-2-methyl-3H-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl (3S)-3-(2,6-difluorophenyl)-2-methyl-3H-1,2-oxazole-5-carboxylate |
| PubChem CID | 139234931 |
| Molecular Formula | C12H11F2NO3 |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | methyl (3S)-3-(2,6-difluorophenyl)-2-methyl-3H-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](c2c(F)cccc2F)N(C)O1 |
| InChI | InChI=1S/C12H11F2NO3/c1-15-9(6-10(18-15)12(16)17-2)11-7(13)4-3-5-8(11)14/h3-6,9H,1-2H3/t9-/m0/s1 |
| InChIKey | GEWVTTFZNLTCRV-VIFPVBQESA-N |
| XLogP | 1.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (3S)-3-(2,6-difluorophenyl)-2-methyl-3H-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-3-(2,6-difluorophenyl)-2-methyl-3H-1,2-oxazole-5-carboxylate?
The IUPAC name of methyl (3S)-3-(2,6-difluorophenyl)-2-methyl-3H-1,2-oxazole-5-carboxylate (CID 139234931) is methyl (3S)-3-(2,6-difluorophenyl)-2-methyl-3H-1,2-oxazole-5-carboxylate.
What is the SMILES notation for methyl (3S)-3-(2,6-difluorophenyl)-2-methyl-3H-1,2-oxazole-5-carboxylate?
The canonical SMILES for methyl (3S)-3-(2,6-difluorophenyl)-2-methyl-3H-1,2-oxazole-5-carboxylate is COC(=O)C1=C[C@@H](c2c(F)cccc2F)N(C)O1.
What is the InChIKey of methyl (3S)-3-(2,6-difluorophenyl)-2-methyl-3H-1,2-oxazole-5-carboxylate?
The InChIKey is GEWVTTFZNLTCRV-VIFPVBQESA-N. The full InChI is InChI=1S/C12H11F2NO3/c1-15-9(6-10(18-15)12(16)17-2)11-7(13)4-3-5-8(11)14/h3-6,9H,1-2H3/t9-/m0/s1.
What are the key properties of methyl (3S)-3-(2,6-difluorophenyl)-2-methyl-3H-1,2-oxazole-5-carboxylate?
methyl (3S)-3-(2,6-difluorophenyl)-2-methyl-3H-1,2-oxazole-5-carboxylate has a molecular weight of 255.22 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-3-(2,6-difluorophenyl)-2-methyl-3H-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 139234931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).