About methyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate
methyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate (PubChem CID 139234945) has the molecular formula C18H15F2NO3
and a molecular weight of 331.32 g/mol. Its IUPAC name is methyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate |
| PubChem CID | 139234945 |
| Molecular Formula | C18H15F2NO3 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | methyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](c2c(F)cccc2F)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C18H15F2NO3/c1-23-18(22)16-10-15(17-13(19)8-5-9-14(17)20)21(24-16)11-12-6-3-2-4-7-12/h2-10,15H,11H2,1H3/t15-/m0/s1 |
| InChIKey | NCGWVPAVJTZVPD-HNNXBMFYSA-N |
| XLogP | 3.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate?
The IUPAC name of methyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate (CID 139234945) is methyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate.
What is the SMILES notation for methyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate?
The canonical SMILES for methyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate is COC(=O)C1=C[C@@H](c2c(F)cccc2F)N(Cc2ccccc2)O1.
What is the InChIKey of methyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate?
The InChIKey is NCGWVPAVJTZVPD-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H15F2NO3/c1-23-18(22)16-10-15(17-13(19)8-5-9-14(17)20)21(24-16)11-12-6-3-2-4-7-12/h2-10,15H,11H2,1H3/t15-/m0/s1.
What are the key properties of methyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate?
methyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate has a molecular weight of 331.32 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-2-benzyl-3-(2,6-difluorophenyl)-3H-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 139234945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).