C13H20N4S2 — CID 139234961
1-(4-methylpiperazin-1-yl)-3-(4-methylsulfanylphenyl)thiourea (PubChem CID 139234961) has the molecular formula C13H20N4S2 and a molecular weight of 296.47 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-3-(4-methylsulfanylphenyl)thiourea.
| Compound Name | 1-(4-methylpiperazin-1-yl)-3-(4-methylsulfanylphenyl)thiourea |
|---|---|
| PubChem CID | 139234961 |
| Molecular Formula | C13H20N4S2 |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-3-(4-methylsulfanylphenyl)thiourea |
| SMILES | CSc1ccc(NC(=S)NN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C13H20N4S2/c1-16-7-9-17(10-8-16)15-13(18)14-11-3-5-12(19-2)6-4-11/h3-6H,7-10H2,1-2H3,(H2,14,15,18) |
| InChIKey | IRZWEVCRVMULIC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|