C20H13F3N4O2 — CID 139235117
1-[2-methyl-8-(trifluoromethyl)quinolin-4-yl]-5-pyridin-3-ylpyrazole-3-carboxylic acid (PubChem CID 139235117) has the molecular formula C20H13F3N4O2 and a molecular weight of 398.34 g/mol. Its IUPAC name is 1-[2-methyl-8-(trifluoromethyl)quinolin-4-yl]-5-pyridin-3-ylpyrazole-3-carboxylic acid.
| Compound Name | 1-[2-methyl-8-(trifluoromethyl)quinolin-4-yl]-5-pyridin-3-ylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 139235117 |
| Molecular Formula | C20H13F3N4O2 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-[2-methyl-8-(trifluoromethyl)quinolin-4-yl]-5-pyridin-3-ylpyrazole-3-carboxylic acid |
| SMILES | Cc1cc(-n2nc(C(=O)O)cc2-c2cccnc2)c2cccc(C(F)(F)F)c2n1 |
| InChI | InChI=1S/C20H13F3N4O2/c1-11-8-17(13-5-2-6-14(18(13)25-11)20(21,22)23)27-16(9-15(26-27)19(28)29)12-4-3-7-24-10-12/h2-10H,1H3,(H,28,29) |
| InChIKey | YVPDAGYARTTXFJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |