C15H16N2O6 — CID 139235407
diethyl 7-methyl-1-nitroindolizine-2,3-dicarboxylate (PubChem CID 139235407) has the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. Its IUPAC name is diethyl 7-methyl-1-nitroindolizine-2,3-dicarboxylate.
| Compound Name | diethyl 7-methyl-1-nitroindolizine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 139235407 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | diethyl 7-methyl-1-nitroindolizine-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1c([N+](=O)[O-])c2cc(C)ccn2c1C(=O)OCC |
| InChI | InChI=1S/C15H16N2O6/c1-4-22-14(18)11-12(17(20)21)10-8-9(3)6-7-16(10)13(11)15(19)23-5-2/h6-8H,4-5H2,1-3H3 |
| InChIKey | WZQVGXCNXKIHKB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|