C28H20N4OS2 — CID 139235508
(4Z)-4-(3,4-diphenyl-1,3-thiazol-2-ylidene)-5-methyl-2-(4-phenyl-1,3-thiazol-2-yl)pyrazol-3-one (PubChem CID 139235508) has the molecular formula C28H20N4OS2 and a molecular weight of 492.63 g/mol. Its IUPAC name is (4Z)-4-(3,4-diphenyl-1,3-thiazol-2-ylidene)-5-methyl-2-(4-phenyl-1,3-thiazol-2-yl)pyrazol-3-one.
| Compound Name | (4Z)-4-(3,4-diphenyl-1,3-thiazol-2-ylidene)-5-methyl-2-(4-phenyl-1,3-thiazol-2-yl)pyrazol-3-one |
|---|---|
| PubChem CID | 139235508 |
| Molecular Formula | C28H20N4OS2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | (4Z)-4-(3,4-diphenyl-1,3-thiazol-2-ylidene)-5-methyl-2-(4-phenyl-1,3-thiazol-2-yl)pyrazol-3-one |
| SMILES | CC1=NN(c2nc(-c3ccccc3)cs2)C(=O)/C1=C1\SC=C(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C28H20N4OS2/c1-19-25(26(33)32(30-19)28-29-23(17-35-28)20-11-5-2-6-12-20)27-31(22-15-9-4-10-16-22)24(18-34-27)21-13-7-3-8-14-21/h2-18H,1H3/b27-25- |
| InChIKey | DMQQDYYBCKGSFF-RFBIWTDZSA-N |
| XLogP | 7.00 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|