C28H18FN3O — CID 139235838
5-(4-fluorophenyl)-2,3-diphenylimidazo[1,2-c]quinazolin-9-ol (PubChem CID 139235838) has the molecular formula C28H18FN3O and a molecular weight of 431.47 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2,3-diphenylimidazo[1,2-c]quinazolin-9-ol.
| Compound Name | 5-(4-fluorophenyl)-2,3-diphenylimidazo[1,2-c]quinazolin-9-ol |
|---|---|
| PubChem CID | 139235838 |
| Molecular Formula | C28H18FN3O |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 5-(4-fluorophenyl)-2,3-diphenylimidazo[1,2-c]quinazolin-9-ol |
| SMILES | Oc1ccc2nc(-c3ccc(F)cc3)n3c(-c4ccccc4)c(-c4ccccc4)nc3c2c1 |
| InChI | InChI=1S/C28H18FN3O/c29-21-13-11-20(12-14-21)27-30-24-16-15-22(33)17-23(24)28-31-25(18-7-3-1-4-8-18)26(32(27)28)19-9-5-2-6-10-19/h1-17,33H |
| InChIKey | HMAQVIDCUHYMFZ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |