C23H18N2O3 — CID 139236058
11-(3-methoxyphenyl)-15-methyl-18-oxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),15-heptaen-13-one (PubChem CID 139236058) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 11-(3-methoxyphenyl)-15-methyl-18-oxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),15-heptaen-13-one.
| Compound Name | 11-(3-methoxyphenyl)-15-methyl-18-oxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),15-heptaen-13-one |
|---|---|
| PubChem CID | 139236058 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 11-(3-methoxyphenyl)-15-methyl-18-oxa-14,16-diazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17),15-heptaen-13-one |
| SMILES | COc1cccc(C2c3ccc4ccccc4c3Oc3nc(C)[nH]c(=O)c32)c1 |
| InChI | InChI=1S/C23H18N2O3/c1-13-24-22(26)20-19(15-7-5-8-16(12-15)27-2)18-11-10-14-6-3-4-9-17(14)21(18)28-23(20)25-13/h3-12,19H,1-2H3,(H,24,25,26) |
| InChIKey | IXSOEGYNAJJGAD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |