C18H10ClN5O — CID 139236333
5-chloro-13-phenyl-2,12,14,15,17-pentazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),2,4,6,8,13,16-heptaen-11-one (PubChem CID 139236333) has the molecular formula C18H10ClN5O and a molecular weight of 347.77 g/mol. Its IUPAC name is 5-chloro-13-phenyl-2,12,14,15,17-pentazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),2,4,6,8,13,16-heptaen-11-one.
| Compound Name | 5-chloro-13-phenyl-2,12,14,15,17-pentazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),2,4,6,8,13,16-heptaen-11-one |
|---|---|
| PubChem CID | 139236333 |
| Molecular Formula | C18H10ClN5O |
| Molecular Weight | 347.77 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 5-chloro-13-phenyl-2,12,14,15,17-pentazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),2,4,6,8,13,16-heptaen-11-one |
| SMILES | O=c1c2cc3ccc(Cl)cc3nc2nc2[nH]nc(-c3ccccc3)n12 |
| InChI | InChI=1S/C18H10ClN5O/c19-12-7-6-11-8-13-15(20-14(11)9-12)21-18-23-22-16(24(18)17(13)25)10-4-2-1-3-5-10/h1-9H,(H,20,21,23) |
| InChIKey | PZGBPJNYZQIQJA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.77 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|