C8H7N7S — CID 139236362
5,8-diamino-3-sulfanylidene-1,2-dihydropyrido[3,2-f][1,2,4]triazepine-7-carbonitrile (PubChem CID 139236362) has the molecular formula C8H7N7S and a molecular weight of 233.26 g/mol. Its IUPAC name is 5,8-diamino-3-sulfanylidene-1,2-dihydropyrido[3,2-f][1,2,4]triazepine-7-carbonitrile.
| Compound Name | 5,8-diamino-3-sulfanylidene-1,2-dihydropyrido[3,2-f][1,2,4]triazepine-7-carbonitrile |
|---|---|
| PubChem CID | 139236362 |
| Molecular Formula | C8H7N7S |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 5,8-diamino-3-sulfanylidene-1,2-dihydropyrido[3,2-f][1,2,4]triazepine-7-carbonitrile |
| SMILES | N#Cc1cc2c(nc1N)NNC(=S)N=C2N |
| InChI | InChI=1S/C8H7N7S/c9-2-3-1-4-6(11)13-8(16)15-14-7(4)12-5(3)10/h1H,(H3,10,12,14)(H3,11,13,15,16) |
| InChIKey | LDLSUNSVORZCNB-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|