C21H17NO4 — CID 139236501
spiro[1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-3,8'-2-oxatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene]-2,6',10'-trione (PubChem CID 139236501) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is spiro[1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-3,8'-2-oxatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene]-2,6',10'-trione.
| Compound Name | spiro[1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-3,8'-2-oxatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene]-2,6',10'-trione |
|---|---|
| PubChem CID | 139236501 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | spiro[1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-3,8'-2-oxatricyclo[7.3.0.03,7]dodeca-1(9),3(7)-diene]-2,6',10'-trione |
| SMILES | O=C1CCC2=C1C1(C(=O)N3CCCc4cccc1c43)C1=C(CCC1=O)O2 |
| InChI | InChI=1S/C21H17NO4/c23-13-6-8-15-17(13)21(18-14(24)7-9-16(18)26-15)12-5-1-3-11-4-2-10-22(19(11)12)20(21)25/h1,3,5H,2,4,6-10H2 |
| InChIKey | JAPKQUJDRSOFIK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |