C22H16N4O3 — CID 139236590
21,21-dimethyl-5,7-dioxa-11,12,13,18-tetrazaheptacyclo[12.10.2.02,10.04,8.011,26.017,25.019,24]hexacosa-1(24),2,4(8),9,12,14(26),15,17(25),18-nonaen-23-one (PubChem CID 139236590) has the molecular formula C22H16N4O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is 21,21-dimethyl-5,7-dioxa-11,12,13,18-tetrazaheptacyclo[12.10.2.02,10.04,8.011,26.017,25.019,24]hexacosa-1(24),2,4(8),9,12,14(26),15,17(25),18-nonaen-23-one.
| Compound Name | 21,21-dimethyl-5,7-dioxa-11,12,13,18-tetrazaheptacyclo[12.10.2.02,10.04,8.011,26.017,25.019,24]hexacosa-1(24),2,4(8),9,12,14(26),15,17(25),18-nonaen-23-one |
|---|---|
| PubChem CID | 139236590 |
| Molecular Formula | C22H16N4O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 21,21-dimethyl-5,7-dioxa-11,12,13,18-tetrazaheptacyclo[12.10.2.02,10.04,8.011,26.017,25.019,24]hexacosa-1(24),2,4(8),9,12,14(26),15,17(25),18-nonaen-23-one |
| SMILES | CC1(C)CC(=O)c2c(nc3ccc4nnn5c6cc7c(cc6c2c3c45)OCO7)C1 |
| InChI | InChI=1S/C22H16N4O3/c1-22(2)7-13-19(15(27)8-22)18-10-5-16-17(29-9-28-16)6-14(10)26-21-12(24-25-26)4-3-11(23-13)20(18)21/h3-6H,7-9H2,1-2H3 |
| InChIKey | OQPQBNWYQPNRKX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|