About 3'-benzoyl-4'-methyl-1'-phenylspiro[3H-indene-2,5'-4H-pyrazole]-1-one
3'-benzoyl-4'-methyl-1'-phenylspiro[3H-indene-2,5'-4H-pyrazole]-1-one (PubChem CID 139236870) has the molecular formula C25H20N2O2
and a molecular weight of 380.45 g/mol. Its IUPAC name is 3'-benzoyl-4'-methyl-1'-phenylspiro[3H-indene-2,5'-4H-pyrazole]-1-one.
Molecular Properties
| Compound Name | 3'-benzoyl-4'-methyl-1'-phenylspiro[3H-indene-2,5'-4H-pyrazole]-1-one |
| PubChem CID | 139236870 |
| Molecular Formula | C25H20N2O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3'-benzoyl-4'-methyl-1'-phenylspiro[3H-indene-2,5'-4H-pyrazole]-1-one |
| SMILES | CC1C(C(=O)c2ccccc2)=NN(c2ccccc2)C12Cc1ccccc1C2=O |
| InChI | InChI=1S/C25H20N2O2/c1-17-22(23(28)18-10-4-2-5-11-18)26-27(20-13-6-3-7-14-20)25(17)16-19-12-8-9-15-21(19)24(25)29/h2-15,17H,16H2,1H3 |
| InChIKey | VQMPRWBDWXOJFH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3'-benzoyl-4'-methyl-1'-phenylspiro[3H-indene-2,5'-4H-pyrazole]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-benzoyl-4'-methyl-1'-phenylspiro[3H-indene-2,5'-4H-pyrazole]-1-one?
The IUPAC name of 3'-benzoyl-4'-methyl-1'-phenylspiro[3H-indene-2,5'-4H-pyrazole]-1-one (CID 139236870) is 3'-benzoyl-4'-methyl-1'-phenylspiro[3H-indene-2,5'-4H-pyrazole]-1-one.
What is the SMILES notation for 3'-benzoyl-4'-methyl-1'-phenylspiro[3H-indene-2,5'-4H-pyrazole]-1-one?
The canonical SMILES for 3'-benzoyl-4'-methyl-1'-phenylspiro[3H-indene-2,5'-4H-pyrazole]-1-one is CC1C(C(=O)c2ccccc2)=NN(c2ccccc2)C12Cc1ccccc1C2=O.
What is the InChIKey of 3'-benzoyl-4'-methyl-1'-phenylspiro[3H-indene-2,5'-4H-pyrazole]-1-one?
The InChIKey is VQMPRWBDWXOJFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N2O2/c1-17-22(23(28)18-10-4-2-5-11-18)26-27(20-13-6-3-7-14-20)25(17)16-19-12-8-9-15-21(19)24(25)29/h2-15,17H,16H2,1H3.
What are the key properties of 3'-benzoyl-4'-methyl-1'-phenylspiro[3H-indene-2,5'-4H-pyrazole]-1-one?
3'-benzoyl-4'-methyl-1'-phenylspiro[3H-indene-2,5'-4H-pyrazole]-1-one has a molecular weight of 380.45 g/mol, XLogP of 4.56, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-benzoyl-4'-methyl-1'-phenylspiro[3H-indene-2,5'-4H-pyrazole]-1-one is sourced from PubChem (CID 139236870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).