C22H23N3O6S — CID 139236969
(4aS,6R,7R,8S,8aR)-5-benzoyl-7,8-dihydroxy-6-(hydroxymethyl)-2-(4-methoxyphenyl)imino-6,7,8,8a-tetrahydro-4aH-pyrido[2,3-e][1,3]thiazin-4-one (PubChem CID 139236969) has the molecular formula C22H23N3O6S and a molecular weight of 457.51 g/mol. Its IUPAC name is (4aS,6R,7R,8S,8aR)-5-benzoyl-7,8-dihydroxy-6-(hydroxymethyl)-2-(4-methoxyphenyl)imino-6,7,8,8a-tetrahydro-4aH-pyrido[2,3-e][1,3]thiazin-4-one.
| Compound Name | (4aS,6R,7R,8S,8aR)-5-benzoyl-7,8-dihydroxy-6-(hydroxymethyl)-2-(4-methoxyphenyl)imino-6,7,8,8a-tetrahydro-4aH-pyrido[2,3-e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 139236969 |
| Molecular Formula | C22H23N3O6S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | (4aS,6R,7R,8S,8aR)-5-benzoyl-7,8-dihydroxy-6-(hydroxymethyl)-2-(4-methoxyphenyl)imino-6,7,8,8a-tetrahydro-4aH-pyrido[2,3-e][1,3]thiazin-4-one |
| SMILES | COc1ccc(/N=C2/NC(=O)[C@H]3[C@@H](S2)[C@@H](O)[C@H](O)[C@@H](CO)N3C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23N3O6S/c1-31-14-9-7-13(8-10-14)23-22-24-20(29)16-19(32-22)18(28)17(27)15(11-26)25(16)21(30)12-5-3-2-4-6-12/h2-10,15-19,26-28H,11H2,1H3,(H,23,24,29)/t15-,16-,17-,18+,19-/m1/s1 |
| InChIKey | MMCYAZFCAHPVKH-IEWDOMPSSA-N |
| XLogP | 0.52 |
| TPSA | 131.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|