C17H25NO3 — CID 139237416
2-phenoxy-1-(2,2,4-triethyl-1,3-oxazolidin-3-yl)ethanone (PubChem CID 139237416) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-phenoxy-1-(2,2,4-triethyl-1,3-oxazolidin-3-yl)ethanone.
| Compound Name | 2-phenoxy-1-(2,2,4-triethyl-1,3-oxazolidin-3-yl)ethanone |
|---|---|
| PubChem CID | 139237416 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-phenoxy-1-(2,2,4-triethyl-1,3-oxazolidin-3-yl)ethanone |
| SMILES | CCC1COC(CC)(CC)N1C(=O)COc1ccccc1 |
| InChI | InChI=1S/C17H25NO3/c1-4-14-12-21-17(5-2,6-3)18(14)16(19)13-20-15-10-8-7-9-11-15/h7-11,14H,4-6,12-13H2,1-3H3 |
| InChIKey | CAWTYEOPNTYKGT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |