About ethyl 1-acetyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate
ethyl 1-acetyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate (PubChem CID 139237460) has the molecular formula C15H17NO4
and a molecular weight of 275.30 g/mol. Its IUPAC name is ethyl 1-acetyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-acetyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate |
| PubChem CID | 139237460 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | ethyl 1-acetyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(C)=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H17NO4/c1-3-20-15(19)12-8-9-16(10(2)17)13-7-5-4-6-11(13)14(12)18/h4-7,12H,3,8-9H2,1-2H3 |
| InChIKey | SYWORSVWGLRNQH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-acetyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-acetyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate?
The IUPAC name of ethyl 1-acetyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate (CID 139237460) is ethyl 1-acetyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate.
What is the SMILES notation for ethyl 1-acetyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate?
The canonical SMILES for ethyl 1-acetyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate is CCOC(=O)C1CCN(C(C)=O)c2ccccc2C1=O.
What is the InChIKey of ethyl 1-acetyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate?
The InChIKey is SYWORSVWGLRNQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO4/c1-3-20-15(19)12-8-9-16(10(2)17)13-7-5-4-6-11(13)14(12)18/h4-7,12H,3,8-9H2,1-2H3.
What are the key properties of ethyl 1-acetyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate?
ethyl 1-acetyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate has a molecular weight of 275.30 g/mol, XLogP of 1.81, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-acetyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate is sourced from PubChem (CID 139237460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).