C21H23N3O2 — CID 139237693
N-(4-methoxyphenyl)-5-methyl-3-phenyl-2,6,7,8-tetrahydrocyclopenta[e][1,3,4]oxadiazepin-3-amine (PubChem CID 139237693) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-5-methyl-3-phenyl-2,6,7,8-tetrahydrocyclopenta[e][1,3,4]oxadiazepin-3-amine.
| Compound Name | N-(4-methoxyphenyl)-5-methyl-3-phenyl-2,6,7,8-tetrahydrocyclopenta[e][1,3,4]oxadiazepin-3-amine |
|---|---|
| PubChem CID | 139237693 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-(4-methoxyphenyl)-5-methyl-3-phenyl-2,6,7,8-tetrahydrocyclopenta[e][1,3,4]oxadiazepin-3-amine |
| SMILES | COc1ccc(NC2(c3ccccc3)NN=C3CCCC3=C(C)O2)cc1 |
| InChI | InChI=1S/C21H23N3O2/c1-15-19-9-6-10-20(19)23-24-21(26-15,16-7-4-3-5-8-16)22-17-11-13-18(25-2)14-12-17/h3-5,7-8,11-14,22,24H,6,9-10H2,1-2H3 |
| InChIKey | PCCJIPGMNUSNAZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|